Showing 46 of 120 total issues
File core.py
has 1842 lines of code (exceeds 250 allowed). Consider refactoring. Open
""" BcForms
:Author: Mike Zheng <xzheng20@colby.edu>
:Author: Jonathan Karr <karr@mssm.edu>
:Date: 2019-06-25
Function get_structure
has a Cognitive Complexity of 90 (exceeds 5 allowed). Consider refactoring. Open
def get_structure(self):
""" Get an Open Babel molecule of the structure
Returns:
:obj:`openbabel.OBMol`: Open Babel molecule of the structure
- Read upRead up
Cognitive Complexity
Cognitive Complexity is a measure of how difficult a unit of code is to intuitively understand. Unlike Cyclomatic Complexity, which determines how difficult your code will be to test, Cognitive Complexity tells you how difficult your code will be to read and comprehend.
A method's cognitive complexity is based on a few simple rules:
- Code is not considered more complex when it uses shorthand that the language provides for collapsing multiple statements into one
- Code is considered more complex for each "break in the linear flow of the code"
- Code is considered more complex when "flow breaking structures are nested"
Further reading
Function post
has a Cognitive Complexity of 86 (exceeds 5 allowed). Consider refactoring. Open
def post(self):
ret = {}
warnings = []
args = bcform_ns.payload
- Read upRead up
Cognitive Complexity
Cognitive Complexity is a measure of how difficult a unit of code is to intuitively understand. Unlike Cyclomatic Complexity, which determines how difficult your code will be to test, Cognitive Complexity tells you how difficult your code will be to read and comprehend.
A method's cognitive complexity is based on a few simple rules:
- Code is not considered more complex when it uses shorthand that the language provides for collapsing multiple statements into one
- Code is considered more complex for each "break in the linear flow of the code"
- Code is considered more complex when "flow breaking structures are nested"
Further reading
Function from_str
has a Cognitive Complexity of 51 (exceeds 5 allowed). Consider refactoring. Open
def from_str(self, string):
""" Set a complex from a string representation
Args:
string (:obj:`str`): string representation of a complex
- Read upRead up
Cognitive Complexity
Cognitive Complexity is a measure of how difficult a unit of code is to intuitively understand. Unlike Cyclomatic Complexity, which determines how difficult your code will be to test, Cognitive Complexity tells you how difficult your code will be to read and comprehend.
A method's cognitive complexity is based on a few simple rules:
- Code is not considered more complex when it uses shorthand that the language provides for collapsing multiple statements into one
- Code is considered more complex for each "break in the linear flow of the code"
- Code is considered more complex when "flow breaking structures are nested"
Further reading
Function draw_xlink
has a Cognitive Complexity of 33 (exceeds 5 allowed). Consider refactoring. Open
def draw_xlink(xlink_name, include_all_hydrogens=False, remove_hydrogens=True, show_atom_nums=False,
l_color=0x00ea4e, r_color=0x00adef, bond_color=0xea4200,
width=300, height=200, atom_label_font_size=0.6,
image_format='png', include_xml_header=False):
""" Generate an image of a crosslink
- Read upRead up
Cognitive Complexity
Cognitive Complexity is a measure of how difficult a unit of code is to intuitively understand. Unlike Cyclomatic Complexity, which determines how difficult your code will be to test, Cognitive Complexity tells you how difficult your code will be to read and comprehend.
A method's cognitive complexity is based on a few simple rules:
- Code is not considered more complex when it uses shorthand that the language provides for collapsing multiple statements into one
- Code is considered more complex for each "break in the linear flow of the code"
- Code is considered more complex when "flow breaking structures are nested"
Further reading
Function get_genomic_image
has a Cognitive Complexity of 29 (exceeds 5 allowed). Consider refactoring. Open
def get_genomic_image(self, seq_features=None, width=1200, cols=2, nt_per_track=80, **kwargs):
""" Get a genomic visualization of the :obj:`BpForm`
Args:
seq_features (:obj:`dict`): list of features each
- Read upRead up
Cognitive Complexity
Cognitive Complexity is a measure of how difficult a unit of code is to intuitively understand. Unlike Cyclomatic Complexity, which determines how difficult your code will be to test, Cognitive Complexity tells you how difficult your code will be to read and comprehend.
A method's cognitive complexity is based on a few simple rules:
- Code is not considered more complex when it uses shorthand that the language provides for collapsing multiple statements into one
- Code is considered more complex for each "break in the linear flow of the code"
- Code is considered more complex when "flow breaking structures are nested"
Further reading
Function get_formula
has a Cognitive Complexity of 21 (exceeds 5 allowed). Consider refactoring. Open
def get_formula(self, subunit_formulas=None):
""" Get the empirical formula
* If user wants to calculate formula of nested BcForm, where some subunits
are BcForm objects, then the subunit BcForms must be able to calculate
- Read upRead up
Cognitive Complexity
Cognitive Complexity is a measure of how difficult a unit of code is to intuitively understand. Unlike Cyclomatic Complexity, which determines how difficult your code will be to test, Cognitive Complexity tells you how difficult your code will be to read and comprehend.
A method's cognitive complexity is based on a few simple rules:
- Code is not considered more complex when it uses shorthand that the language provides for collapsing multiple statements into one
- Code is considered more complex for each "break in the linear flow of the code"
- Code is considered more complex when "flow breaking structures are nested"
Further reading
Function get_mol_wt
has a Cognitive Complexity of 21 (exceeds 5 allowed). Consider refactoring. Open
def get_mol_wt(self, subunit_mol_wts=None):
""" Get the molecular weight
* If user wants to calculate molecular weight of nested BcForm, where
some subunits are BcForm objects, then the subunit BcForms must be able
- Read upRead up
Cognitive Complexity
Cognitive Complexity is a measure of how difficult a unit of code is to intuitively understand. Unlike Cyclomatic Complexity, which determines how difficult your code will be to test, Cognitive Complexity tells you how difficult your code will be to read and comprehend.
A method's cognitive complexity is based on a few simple rules:
- Code is not considered more complex when it uses shorthand that the language provides for collapsing multiple statements into one
- Code is considered more complex for each "break in the linear flow of the code"
- Code is considered more complex when "flow breaking structures are nested"
Further reading
Function get_charge
has a Cognitive Complexity of 21 (exceeds 5 allowed). Consider refactoring. Open
def get_charge(self, subunit_charges=None):
""" Get the total charge
* If user wants to calculate charge of nested BcForm, where
some subunits are BcForm objects, then the subunit BcForms must be able
- Read upRead up
Cognitive Complexity
Cognitive Complexity is a measure of how difficult a unit of code is to intuitively understand. Unlike Cyclomatic Complexity, which determines how difficult your code will be to test, Cognitive Complexity tells you how difficult your code will be to read and comprehend.
A method's cognitive complexity is based on a few simple rules:
- Code is not considered more complex when it uses shorthand that the language provides for collapsing multiple statements into one
- Code is considered more complex for each "break in the linear flow of the code"
- Code is considered more complex when "flow breaking structures are nested"
Further reading
Function is_equal
has a Cognitive Complexity of 20 (exceeds 5 allowed). Consider refactoring. Open
def is_equal(self, other):
""" Check if two complexes are semantically equal (same subunits and crosslinks)
Args:
other (:obj:`BcForm`): another complex
- Read upRead up
Cognitive Complexity
Cognitive Complexity is a measure of how difficult a unit of code is to intuitively understand. Unlike Cyclomatic Complexity, which determines how difficult your code will be to test, Cognitive Complexity tells you how difficult your code will be to read and comprehend.
A method's cognitive complexity is based on a few simple rules:
- Code is not considered more complex when it uses shorthand that the language provides for collapsing multiple statements into one
- Code is considered more complex for each "break in the linear flow of the code"
- Code is considered more complex when "flow breaking structures are nested"
Further reading
OntologyCrosslink
has 23 functions (exceeds 20 allowed). Consider refactoring. Open
class OntologyCrosslink(Crosslink):
""" A pre-defined crosslink between subunits
Attributes:
type (:obj:`str`): type of the pre-defined crosslink
Function validate
has a Cognitive Complexity of 18 (exceeds 5 allowed). Consider refactoring. Open
def validate(self):
""" Check if the BcForm is valid
* Check if the crosslinking subunit is in the subunit list and if the `subunit_idx` is valid
- Read upRead up
Cognitive Complexity
Cognitive Complexity is a measure of how difficult a unit of code is to intuitively understand. Unlike Cyclomatic Complexity, which determines how difficult your code will be to test, Cognitive Complexity tells you how difficult your code will be to read and comprehend.
A method's cognitive complexity is based on a few simple rules:
- Code is not considered more complex when it uses shorthand that the language provides for collapsing multiple statements into one
- Code is considered more complex for each "break in the linear flow of the code"
- Code is considered more complex when "flow breaking structures are nested"
Further reading
InlineCrosslink
has 22 functions (exceeds 20 allowed). Consider refactoring. Open
class InlineCrosslink(Crosslink):
""" A crosslink between subunits defined inline
Attributes:
l_bond_atoms (:obj:`list` of :obj:`Atom`): atoms from the left subunit that bond with the right subunit
Function get_structure
has a Cognitive Complexity of 17 (exceeds 5 allowed). Consider refactoring. Open
def get_structure(self):
""" Get an Open Babel molecule of the structure
Returns:
:obj:`tuple`:
- Read upRead up
Cognitive Complexity
Cognitive Complexity is a measure of how difficult a unit of code is to intuitively understand. Unlike Cyclomatic Complexity, which determines how difficult your code will be to test, Cognitive Complexity tells you how difficult your code will be to read and comprehend.
A method's cognitive complexity is based on a few simple rules:
- Code is not considered more complex when it uses shorthand that the language provides for collapsing multiple statements into one
- Code is considered more complex for each "break in the linear flow of the code"
- Code is considered more complex when "flow breaking structures are nested"
Further reading
Function add_subunit
has 43 lines of code (exceeds 25 allowed). Consider refactoring. Open
function add_subunit() {
tabs = $('#tabs_subunits_dynamic')
num_subunits = tabs.children().length - 1
$('#tab_add_title').before(' \
Function is_equal
has a Cognitive Complexity of 13 (exceeds 5 allowed). Consider refactoring. Open
def is_equal(self, other):
""" Check if two crosslinks are semantically equal (have the same bond atoms)
Args:
other (:obj:`Crosslink`): another crosslink
- Read upRead up
Cognitive Complexity
Cognitive Complexity is a measure of how difficult a unit of code is to intuitively understand. Unlike Cyclomatic Complexity, which determines how difficult your code will be to test, Cognitive Complexity tells you how difficult your code will be to read and comprehend.
A method's cognitive complexity is based on a few simple rules:
- Code is not considered more complex when it uses shorthand that the language provides for collapsing multiple statements into one
- Code is considered more complex for each "break in the linear flow of the code"
- Code is considered more complex when "flow breaking structures are nested"
Further reading
Function draw_xlink
has 12 arguments (exceeds 4 allowed). Consider refactoring. Open
def draw_xlink(xlink_name, include_all_hydrogens=False, remove_hydrogens=True, show_atom_nums=False,
Function draw_xlink
has 27 lines of code (exceeds 25 allowed). Consider refactoring. Open
def draw_xlink(xlink_name, include_all_hydrogens=False, remove_hydrogens=True, show_atom_nums=False,
l_color=0x00ea4e, r_color=0x00adef, bond_color=0xea4200,
width=300, height=200, atom_label_font_size=0.6,
image_format='png', include_xml_header=False):
""" Generate an image of a crosslink
Function __init__
has 7 arguments (exceeds 4 allowed). Consider refactoring. Open
def __init__(self, type, l_subunit, l_monomer, r_subunit, r_monomer, l_subunit_idx=None, r_subunit_idx=None):
Function __init__
has 7 arguments (exceeds 4 allowed). Consider refactoring. Open
def __init__(self, subunit, element, position, monomer, charge=0, subunit_idx=None, component_type=None):